C15H13FN2O4 — CID 54202201
4-[1-[(4-fluorophenyl)methyl]-5-methylpyrazol-4-yl]-2,4-dioxobutanoic acid (PubChem CID 54202201) has the molecular formula C15H13FN2O4 and a molecular weight of 304.28 g/mol. Its IUPAC name is 4-[1-[(4-fluorophenyl)methyl]-5-methylpyrazol-4-yl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[1-[(4-fluorophenyl)methyl]-5-methylpyrazol-4-yl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 54202201 |
| Molecular Formula | C15H13FN2O4 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 4-[1-[(4-fluorophenyl)methyl]-5-methylpyrazol-4-yl]-2,4-dioxobutanoic acid |
| SMILES | Cc1c(C(=O)CC(=O)C(=O)O)cnn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H13FN2O4/c1-9-12(13(19)6-14(20)15(21)22)7-17-18(9)8-10-2-4-11(16)5-3-10/h2-5,7H,6,8H2,1H3,(H,21,22) |
| InChIKey | PQAPDESLEPTLGR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|