C22H16F2N2O6 — CID 11554026
4-[1,3-bis[(4-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-2,4-dioxobutanoic acid (PubChem CID 11554026) has the molecular formula C22H16F2N2O6 and a molecular weight of 442.37 g/mol. Its IUPAC name is 4-[1,3-bis[(4-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[1,3-bis[(4-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 11554026 |
| Molecular Formula | C22H16F2N2O6 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 4-[1,3-bis[(4-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cn(Cc2ccc(F)cc2)c(=O)n(Cc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C22H16F2N2O6/c23-15-5-1-13(2-6-15)10-25-12-17(18(27)9-19(28)21(30)31)20(29)26(22(25)32)11-14-3-7-16(24)8-4-14/h1-8,12H,9-11H2,(H,30,31) |
| InChIKey | QHSWFUQVAJNRKO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|