(2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide

C9H14INO — CID 10826500

IUPAC(2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide
SMILESCc1cc(=[N+](C)C)cc(C)o1.[I-]
InChIInChI=1S/C9H14NO.HI/c1-7-5-9(10(3)4)6-8(2)11-7;/h5-6H,1-4H3;1H/q+1;/p-1
InChIKeyAYWDJGWNGZTZBE-UHFFFAOYSA-M
MW279.12 g/mol
LogP-2.07
Rot. Bonds

About (2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide

(2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide (PubChem CID 10826500) has the molecular formula C9H14INO and a molecular weight of 279.12 g/mol. Its IUPAC name is (2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide.

Molecular Properties

Compound Name(2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide
PubChem CID10826500
Molecular FormulaC9H14INO
Molecular Weight279.12 g/mol
Exact Mass279.01
IUPAC Name(2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide
SMILESCc1cc(=[N+](C)C)cc(C)o1.[I-]
InChIInChI=1S/C9H14NO.HI/c1-7-5-9(10(3)4)6-8(2)11-7;/h5-6H,1-4H3;1H/q+1;/p-1
InChIKeyAYWDJGWNGZTZBE-UHFFFAOYSA-M
XLogP-2.07
TPSA16.15 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.12
LogP ≤ 5-2.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze (2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide?
The IUPAC name of (2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide (CID 10826500) is (2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide.
What is the SMILES notation for (2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide?
The canonical SMILES for (2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide is Cc1cc(=[N+](C)C)cc(C)o1.[I-].
What is the InChIKey of (2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide?
The InChIKey is AYWDJGWNGZTZBE-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H14NO.HI/c1-7-5-9(10(3)4)6-8(2)11-7;/h5-6H,1-4H3;1H/q+1;/p-1.
What are the key properties of (2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide?
(2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide has a molecular weight of 279.12 g/mol, XLogP of -2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylpyran-4-ylidene)-dimethylazanium iodide is sourced from PubChem (CID 10826500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).