C9H14NO+ — CID 5325147
(2,6-dimethylpyran-4-ylidene)-dimethylazanium (PubChem CID 5325147) has the molecular formula C9H14NO+ and a molecular weight of 152.22 g/mol. Its IUPAC name is (2,6-dimethylpyran-4-ylidene)-dimethylazanium.
| Compound Name | (2,6-dimethylpyran-4-ylidene)-dimethylazanium |
|---|---|
| PubChem CID | 5325147 |
| Molecular Formula | C9H14NO+ |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | (2,6-dimethylpyran-4-ylidene)-dimethylazanium |
| SMILES | Cc1cc(=[N+](C)C)cc(C)o1 |
| InChI | InChI=1S/C9H14NO/c1-7-5-9(10(3)4)6-8(2)11-7/h5-6H,1-4H3/q+1 |
| InChIKey | TUFAPUCHPQYURJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 16.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|