About [(E)-pent-2-en-2-yl] N-methylethanimidate
[(E)-pent-2-en-2-yl] N-methylethanimidate (PubChem CID 164574589) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is [(E)-pent-2-en-2-yl] N-methylethanimidate.
Molecular Properties
| Compound Name | [(E)-pent-2-en-2-yl] N-methylethanimidate |
| PubChem CID | 164574589 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | [(E)-pent-2-en-2-yl] N-methylethanimidate |
| SMILES | CC/C=C(\C)O/C(C)=N/C |
| InChI | InChI=1S/C8H15NO/c1-5-6-7(2)10-8(3)9-4/h6H,5H2,1-4H3/b7-6+,9-8+ |
| InChIKey | FWRKOWLYTHJJLW-BLHCBFLLSA-N |
| XLogP | 2.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [(E)-pent-2-en-2-yl] N-methylethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-pent-2-en-2-yl] N-methylethanimidate?
The IUPAC name of [(E)-pent-2-en-2-yl] N-methylethanimidate (CID 164574589) is [(E)-pent-2-en-2-yl] N-methylethanimidate.
What is the SMILES notation for [(E)-pent-2-en-2-yl] N-methylethanimidate?
The canonical SMILES for [(E)-pent-2-en-2-yl] N-methylethanimidate is CC/C=C(\C)O/C(C)=N/C.
What is the InChIKey of [(E)-pent-2-en-2-yl] N-methylethanimidate?
The InChIKey is FWRKOWLYTHJJLW-BLHCBFLLSA-N. The full InChI is InChI=1S/C8H15NO/c1-5-6-7(2)10-8(3)9-4/h6H,5H2,1-4H3/b7-6+,9-8+.
What are the key properties of [(E)-pent-2-en-2-yl] N-methylethanimidate?
[(E)-pent-2-en-2-yl] N-methylethanimidate has a molecular weight of 141.21 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-pent-2-en-2-yl] N-methylethanimidate is sourced from PubChem (CID 164574589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).