C8H13NO — CID 91242441
4-ethyl-2,6-dimethyl-4H-1,3-oxazine (PubChem CID 91242441) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 4-ethyl-2,6-dimethyl-4H-1,3-oxazine.
| Compound Name | 4-ethyl-2,6-dimethyl-4H-1,3-oxazine |
|---|---|
| PubChem CID | 91242441 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 4-ethyl-2,6-dimethyl-4H-1,3-oxazine |
| SMILES | CCC1C=C(C)OC(C)=N1 |
| InChI | InChI=1S/C8H13NO/c1-4-8-5-6(2)10-7(3)9-8/h5,8H,4H2,1-3H3 |
| InChIKey | WHBGHAOCHWWRHU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |