C9H15NO — CID 91016798
4,6-dimethyl-2-propan-2-yl-4H-1,3-oxazine (PubChem CID 91016798) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 4,6-dimethyl-2-propan-2-yl-4H-1,3-oxazine.
| Compound Name | 4,6-dimethyl-2-propan-2-yl-4H-1,3-oxazine |
|---|---|
| PubChem CID | 91016798 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4,6-dimethyl-2-propan-2-yl-4H-1,3-oxazine |
| SMILES | CC1=CC(C)N=C(C(C)C)O1 |
| InChI | InChI=1S/C9H15NO/c1-6(2)9-10-7(3)5-8(4)11-9/h5-7H,1-4H3 |
| InChIKey | SPEHDBUSJLWJRC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |