C8H11NO — CID 143182598
2-methoxy-N-methylcyclohexa-2,5-dien-1-imine (PubChem CID 143182598) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 2-methoxy-N-methylcyclohexa-2,5-dien-1-imine.
| Compound Name | 2-methoxy-N-methylcyclohexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 143182598 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 2-methoxy-N-methylcyclohexa-2,5-dien-1-imine |
| SMILES | C/N=C1\C=CCC=C1OC |
| InChI | InChI=1S/C8H11NO/c1-9-7-5-3-4-6-8(7)10-2/h3,5-6H,4H2,1-2H3/b9-7+ |
| InChIKey | FFEUUAKFXJGMQA-VQHVLOKHSA-N |
| XLogP | 1.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|