C8H11NO — CID 140784052
6-ethenyl-5-methoxy-2,3-dihydropyridine (PubChem CID 140784052) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 6-ethenyl-5-methoxy-2,3-dihydropyridine.
| Compound Name | 6-ethenyl-5-methoxy-2,3-dihydropyridine |
|---|---|
| PubChem CID | 140784052 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 6-ethenyl-5-methoxy-2,3-dihydropyridine |
| SMILES | C=CC1=NCCC=C1OC |
| InChI | InChI=1S/C8H11NO/c1-3-7-8(10-2)5-4-6-9-7/h3,5H,1,4,6H2,2H3 |
| InChIKey | HPLQJGSJALARNO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |