C9H13NO2 — CID 140784054
6-ethenyl-4,5-dimethoxy-2,3-dihydropyridine (PubChem CID 140784054) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 6-ethenyl-4,5-dimethoxy-2,3-dihydropyridine.
| Compound Name | 6-ethenyl-4,5-dimethoxy-2,3-dihydropyridine |
|---|---|
| PubChem CID | 140784054 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 6-ethenyl-4,5-dimethoxy-2,3-dihydropyridine |
| SMILES | C=CC1=NCCC(OC)=C1OC |
| InChI | InChI=1S/C9H13NO2/c1-4-7-9(12-3)8(11-2)5-6-10-7/h4H,1,5-6H2,2-3H3 |
| InChIKey | VNONMYRMRNRJOB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |