C8H13NO — CID 152997591
4-methoxy-3,6-dimethyl-2,3-dihydropyridine (PubChem CID 152997591) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 4-methoxy-3,6-dimethyl-2,3-dihydropyridine.
| Compound Name | 4-methoxy-3,6-dimethyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 152997591 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 4-methoxy-3,6-dimethyl-2,3-dihydropyridine |
| SMILES | COC1=CC(C)=NCC1C |
| InChI | InChI=1S/C8H13NO/c1-6-5-9-7(2)4-8(6)10-3/h4,6H,5H2,1-3H3 |
| InChIKey | UXNLDKFSCKHGHT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |