C9H15NO — CID 143063364
(3E,5E)-3-methoxy-N-methylhepta-3,5-dien-2-imine (PubChem CID 143063364) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (3E,5E)-3-methoxy-N-methylhepta-3,5-dien-2-imine.
| Compound Name | (3E,5E)-3-methoxy-N-methylhepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 143063364 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3E,5E)-3-methoxy-N-methylhepta-3,5-dien-2-imine |
| SMILES | C/C=C/C=C(OC)\C(C)=N\C |
| InChI | InChI=1S/C9H15NO/c1-5-6-7-9(11-4)8(2)10-3/h5-7H,1-4H3/b6-5+,9-7+,10-8+ |
| InChIKey | TYFKHHIQKMKFTD-NRIIQWGUSA-N |
| XLogP | 2.18 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|