C8H13NO — CID 123834616
(3Z)-5-methoxy-N-methylhexa-3,5-dien-2-imine (PubChem CID 123834616) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (3Z)-5-methoxy-N-methylhexa-3,5-dien-2-imine.
| Compound Name | (3Z)-5-methoxy-N-methylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 123834616 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (3Z)-5-methoxy-N-methylhexa-3,5-dien-2-imine |
| SMILES | C=C(/C=C\C(C)=N\C)OC |
| InChI | InChI=1S/C8H13NO/c1-7(9-3)5-6-8(2)10-4/h5-6H,2H2,1,3-4H3/b6-5-,9-7+ |
| InChIKey | IQLHJDMQLRYJIU-BZWSEGBZSA-N |
| XLogP | 1.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|