C8H11F2NO — CID 142928979
(3E)-1,1-difluoro-4-methoxy-N-methylhexa-3,5-dien-2-imine (PubChem CID 142928979) has the molecular formula C8H11F2NO and a molecular weight of 175.18 g/mol. Its IUPAC name is (3E)-1,1-difluoro-4-methoxy-N-methylhexa-3,5-dien-2-imine.
| Compound Name | (3E)-1,1-difluoro-4-methoxy-N-methylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 142928979 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (3E)-1,1-difluoro-4-methoxy-N-methylhexa-3,5-dien-2-imine |
| SMILES | C=C/C(=C\C(=N\C)C(F)F)OC |
| InChI | InChI=1S/C8H11F2NO/c1-4-6(12-3)5-7(11-2)8(9)10/h4-5,8H,1H2,2-3H3/b6-5+,11-7- |
| InChIKey | CTIGQXJVORXBRR-VLHCFCLRSA-N |
| XLogP | 2.04 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|