C10H15NO — CID 142918153
(3E,5Z)-5-methoxy-N-methylocta-3,5,7-trien-2-imine (PubChem CID 142918153) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (3E,5Z)-5-methoxy-N-methylocta-3,5,7-trien-2-imine.
| Compound Name | (3E,5Z)-5-methoxy-N-methylocta-3,5,7-trien-2-imine |
|---|---|
| PubChem CID | 142918153 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3E,5Z)-5-methoxy-N-methylocta-3,5,7-trien-2-imine |
| SMILES | C=C/C=C(/C=C/C(C)=N/C)OC |
| InChI | InChI=1S/C10H15NO/c1-5-6-10(12-4)8-7-9(2)11-3/h5-8H,1H2,2-4H3/b8-7+,10-6-,11-9+ |
| InChIKey | AJSWPAZNFAZVIJ-KTXBIABASA-N |
| XLogP | 2.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|