C8H13NO — CID 91044401
(3Z)-5-methoxyhepta-3,5-dien-2-imine (PubChem CID 91044401) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (3Z)-5-methoxyhepta-3,5-dien-2-imine.
| Compound Name | (3Z)-5-methoxyhepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 91044401 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (3Z)-5-methoxyhepta-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C=C\C(=CC)OC |
| InChI | InChI=1S/C8H13NO/c1-4-8(10-3)6-5-7(2)9/h4-6,9H,1-3H3/b6-5-,8-4?,9-7+ |
| InChIKey | WPNADRMMWUJOID-ATTDXYCNSA-N |
| XLogP | 2.13 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|