C9H13F2NO — CID 176552719
N-[(3E,5Z)-4-(difluoromethoxy)hepta-3,5-dien-3-yl]methanimine (PubChem CID 176552719) has the molecular formula C9H13F2NO and a molecular weight of 189.21 g/mol. Its IUPAC name is N-[(3E,5Z)-4-(difluoromethoxy)hepta-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3E,5Z)-4-(difluoromethoxy)hepta-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 176552719 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-[(3E,5Z)-4-(difluoromethoxy)hepta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(CC)=C(\C=C/C)OC(F)F |
| InChI | InChI=1S/C9H13F2NO/c1-4-6-8(13-9(10)11)7(5-2)12-3/h4,6,9H,3,5H2,1-2H3/b6-4-,8-7+ |
| InChIKey | DSWOQUYQWVAQDO-IQTBQJLQSA-N |
| XLogP | 3.12 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|