C8H13NO — CID 171630642
N-[(3E)-4-methoxyhexa-3,5-dien-3-yl]methanimine (PubChem CID 171630642) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is N-[(3E)-4-methoxyhexa-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3E)-4-methoxyhexa-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 171630642 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | N-[(3E)-4-methoxyhexa-3,5-dien-3-yl]methanimine |
| SMILES | C=C/C(OC)=C(/CC)N=C |
| InChI | InChI=1S/C8H13NO/c1-5-7(9-3)8(6-2)10-4/h6H,2-3,5H2,1,4H3/b8-7+ |
| InChIKey | RKAKPJLMCVLSKT-BQYQJAHWSA-N |
| XLogP | 2.14 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|