C10H17NO — CID 146604754
N-[(3E,5Z)-4-methoxy-2-methylhepta-3,5-dien-3-yl]methanimine (PubChem CID 146604754) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is N-[(3E,5Z)-4-methoxy-2-methylhepta-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3E,5Z)-4-methoxy-2-methylhepta-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 146604754 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-[(3E,5Z)-4-methoxy-2-methylhepta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C(\C=C/C)OC)C(C)C |
| InChI | InChI=1S/C10H17NO/c1-6-7-9(12-5)10(11-4)8(2)3/h6-8H,4H2,1-3,5H3/b7-6-,10-9+ |
| InChIKey | MEJYIZWSBLNIJR-IXWMQOLASA-N |
| XLogP | 2.78 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|