C7H8F3NO — CID 166104341
N-[(2E)-1,1,1-trifluoro-3-methoxypenta-2,4-dien-2-yl]methanimine (PubChem CID 166104341) has the molecular formula C7H8F3NO and a molecular weight of 179.14 g/mol. Its IUPAC name is N-[(2E)-1,1,1-trifluoro-3-methoxypenta-2,4-dien-2-yl]methanimine.
| Compound Name | N-[(2E)-1,1,1-trifluoro-3-methoxypenta-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 166104341 |
| Molecular Formula | C7H8F3NO |
| Molecular Weight | 179.14 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | N-[(2E)-1,1,1-trifluoro-3-methoxypenta-2,4-dien-2-yl]methanimine |
| SMILES | C=C/C(OC)=C(\N=C)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NO/c1-4-5(12-3)6(11-2)7(8,9)10/h4H,1-2H2,3H3/b6-5+ |
| InChIKey | YVATVVUMXAXGFX-AATRIKPKSA-N |
| XLogP | 2.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.14 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|