C11H17F2NO — CID 162378878
N-[(3E)-4-(2,2-difluoroethoxy)-2,2-dimethylhexa-3,5-dien-3-yl]methanimine (PubChem CID 162378878) has the molecular formula C11H17F2NO and a molecular weight of 217.26 g/mol. Its IUPAC name is N-[(3E)-4-(2,2-difluoroethoxy)-2,2-dimethylhexa-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3E)-4-(2,2-difluoroethoxy)-2,2-dimethylhexa-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 162378878 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | N-[(3E)-4-(2,2-difluoroethoxy)-2,2-dimethylhexa-3,5-dien-3-yl]methanimine |
| SMILES | C=C/C(OCC(F)F)=C(\N=C)C(C)(C)C |
| InChI | InChI=1S/C11H17F2NO/c1-6-8(15-7-9(12)13)10(14-5)11(2,3)4/h6,9H,1,5,7H2,2-4H3/b10-8+ |
| InChIKey | NOTNXIMNPFUKOI-CSKARUKUSA-N |
| XLogP | 3.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|