C10H17F2NO — CID 142928978
(3E)-1,1-difluoro-4-methoxy-N-methylhexa-3,5-dien-2-imine;ethane (PubChem CID 142928978) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is (3E)-1,1-difluoro-4-methoxy-N-methylhexa-3,5-dien-2-imine;ethane.
| Compound Name | (3E)-1,1-difluoro-4-methoxy-N-methylhexa-3,5-dien-2-imine;ethane |
|---|---|
| PubChem CID | 142928978 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (3E)-1,1-difluoro-4-methoxy-N-methylhexa-3,5-dien-2-imine;ethane |
| SMILES | C=C/C(=C\C(=N\C)C(F)F)OC.CC |
| InChI | InChI=1S/C8H11F2NO.C2H6/c1-4-6(12-3)5-7(11-2)8(9)10;1-2/h4-5,8H,1H2,2-3H3;1-2H3/b6-5+,11-7-; |
| InChIKey | LFLXVQVIZQXCSA-COZUZSSBSA-N |
| XLogP | 3.06 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|