About (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine
(6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine (PubChem CID 142275833) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine |
| PubChem CID | 142275833 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine |
| SMILES | C/C=C1/C=CC(OC)=C/C1=N\C |
| InChI | InChI=1S/C10H13NO/c1-4-8-5-6-9(12-3)7-10(8)11-2/h4-7H,1-3H3/b8-4-,11-10+ |
| InChIKey | UPAUIGMXCSMDCG-VCDHSJCMSA-N |
| XLogP | 2.10 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine?
The IUPAC name of (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine (CID 142275833) is (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine.
What is the SMILES notation for (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine?
The canonical SMILES for (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine is C/C=C1/C=CC(OC)=C/C1=N\C.
What is the InChIKey of (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine?
The InChIKey is UPAUIGMXCSMDCG-VCDHSJCMSA-N. The full InChI is InChI=1S/C10H13NO/c1-4-8-5-6-9(12-3)7-10(8)11-2/h4-7H,1-3H3/b8-4-,11-10+.
What are the key properties of (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine?
(6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine has a molecular weight of 163.22 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-ethylidene-3-methoxy-N-methylcyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 142275833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).