C10H9NO — CID 172994105
4-ethenyl-2H-3,1-benzoxazine (PubChem CID 172994105) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 4-ethenyl-2H-3,1-benzoxazine.
| Compound Name | 4-ethenyl-2H-3,1-benzoxazine |
|---|---|
| PubChem CID | 172994105 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 4-ethenyl-2H-3,1-benzoxazine |
| SMILES | C=CC1=c2ccccc2=NCO1 |
| InChI | InChI=1S/C10H9NO/c1-2-10-8-5-3-4-6-9(8)11-7-12-10/h2-6H,1,7H2 |
| InChIKey | IVYYHOMPIUGUQP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |