C10H15NO — CID 143182715
5-ethyl-2-methoxy-N-methylcyclohexa-2,5-dien-1-imine (PubChem CID 143182715) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 5-ethyl-2-methoxy-N-methylcyclohexa-2,5-dien-1-imine.
| Compound Name | 5-ethyl-2-methoxy-N-methylcyclohexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 143182715 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 5-ethyl-2-methoxy-N-methylcyclohexa-2,5-dien-1-imine |
| SMILES | CCC1=C/C(=N\C)C(OC)=CC1 |
| InChI | InChI=1S/C10H15NO/c1-4-8-5-6-10(12-3)9(7-8)11-2/h6-7H,4-5H2,1-3H3/b11-9+ |
| InChIKey | LJXBOVSSQAMHAW-PKNBQFBNSA-N |
| XLogP | 2.33 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|