C16H24O4 — CID 10826608
4-hydroxy-5-methyl-2,3-di(propan-2-yloxy)-4-[(E)-prop-1-enyl]cyclohexa-2,5-dien-1-one (PubChem CID 10826608) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 4-hydroxy-5-methyl-2,3-di(propan-2-yloxy)-4-[(E)-prop-1-enyl]cyclohexa-2,5-dien-1-one.
| Compound Name | 4-hydroxy-5-methyl-2,3-di(propan-2-yloxy)-4-[(E)-prop-1-enyl]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 10826608 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-hydroxy-5-methyl-2,3-di(propan-2-yloxy)-4-[(E)-prop-1-enyl]cyclohexa-2,5-dien-1-one |
| SMILES | C/C=C/C1(O)C(C)=CC(=O)C(OC(C)C)=C1OC(C)C |
| InChI | InChI=1S/C16H24O4/c1-7-8-16(18)12(6)9-13(17)14(19-10(2)3)15(16)20-11(4)5/h7-11,18H,1-6H3/b8-7+ |
| InChIKey | UIYUOSMHLXAKJR-BQYQJAHWSA-N |
| XLogP | 2.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|