C11H14O4 — CID 52913670
(4S)-4-hydroxy-2,5-dimethoxy-4-prop-2-enylcyclohexa-2,5-dien-1-one (PubChem CID 52913670) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (4S)-4-hydroxy-2,5-dimethoxy-4-prop-2-enylcyclohexa-2,5-dien-1-one.
| Compound Name | (4S)-4-hydroxy-2,5-dimethoxy-4-prop-2-enylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 52913670 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (4S)-4-hydroxy-2,5-dimethoxy-4-prop-2-enylcyclohexa-2,5-dien-1-one |
| SMILES | C=CC[C@]1(O)C=C(OC)C(=O)C=C1OC |
| InChI | InChI=1S/C11H14O4/c1-4-5-11(13)7-9(14-2)8(12)6-10(11)15-3/h4,6-7,13H,1,5H2,2-3H3/t11-/m0/s1 |
| InChIKey | DBWCSXUWHNNVMA-NSHDSACASA-N |
| XLogP | 0.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|