C15H24O3S — CID 10826941
(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)-(2,6,6-trimethylcyclohex-2-en-1-yl)methanol (PubChem CID 10826941) has the molecular formula C15H24O3S and a molecular weight of 284.42 g/mol. Its IUPAC name is (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)-(2,6,6-trimethylcyclohex-2-en-1-yl)methanol.
| Compound Name | (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)-(2,6,6-trimethylcyclohex-2-en-1-yl)methanol |
|---|---|
| PubChem CID | 10826941 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)-(2,6,6-trimethylcyclohex-2-en-1-yl)methanol |
| SMILES | CC1=CCCC(C)(C)C1C(O)C1C(C)=CCS1(=O)=O |
| InChI | InChI=1S/C15H24O3S/c1-10-6-5-8-15(3,4)12(10)13(16)14-11(2)7-9-19(14,17)18/h6-7,12-14,16H,5,8-9H2,1-4H3 |
| InChIKey | LLEGNOPWWWOXKR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|