C29H46O3S — CID 10928860
(E)-1-[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl]-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-2-en-1-ol (PubChem CID 10928860) has the molecular formula C29H46O3S and a molecular weight of 474.75 g/mol. Its IUPAC name is (E)-1-[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl]-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-2-en-1-ol.
| Compound Name | (E)-1-[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl]-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-2-en-1-ol |
|---|---|
| PubChem CID | 10928860 |
| Molecular Formula | C29H46O3S |
| Molecular Weight | 474.75 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (E)-1-[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl]-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-2-en-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC1C=C(C)C(C(O)/C(C)=C/CC2=C(C)CCCC2(C)C)S1(=O)=O |
| InChI | InChI=1S/C29H46O3S/c1-20(2)11-9-12-21(3)14-16-25-19-24(6)28(33(25,31)32)27(30)23(5)15-17-26-22(4)13-10-18-29(26,7)8/h11,14-15,19,25,27-28,30H,9-10,12-13,16-18H2,1-8H3/b21-14+,23-15+ |
| InChIKey | JRYJGLNOUWSUEA-UJOYTAFJSA-N |
| XLogP | 7.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.75 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|