C15H25NO5 — CID 10828004
methyl (E)-2-acetamido-3-(2,2-dimethylpropanoyloxy)hept-2-enoate (PubChem CID 10828004) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl (E)-2-acetamido-3-(2,2-dimethylpropanoyloxy)hept-2-enoate.
| Compound Name | methyl (E)-2-acetamido-3-(2,2-dimethylpropanoyloxy)hept-2-enoate |
|---|---|
| PubChem CID | 10828004 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | methyl (E)-2-acetamido-3-(2,2-dimethylpropanoyloxy)hept-2-enoate |
| SMILES | CCCC/C(OC(=O)C(C)(C)C)=C(\NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C15H25NO5/c1-7-8-9-11(21-14(19)15(3,4)5)12(13(18)20-6)16-10(2)17/h7-9H2,1-6H3,(H,16,17)/b12-11+ |
| InChIKey | KZZNJIVYSFPUIW-VAWYXSNFSA-N |
| XLogP | 2.29 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|