C15H30O2 — CID 87147790
hexan-2-one;2,2,4,4-tetramethylpentan-3-one (PubChem CID 87147790) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is hexan-2-one;2,2,4,4-tetramethylpentan-3-one.
| Compound Name | hexan-2-one;2,2,4,4-tetramethylpentan-3-one |
|---|---|
| PubChem CID | 87147790 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | hexan-2-one;2,2,4,4-tetramethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)C(C)(C)C.CCCCC(C)=O |
| InChI | InChI=1S/C9H18O.C6H12O/c1-8(2,3)7(10)9(4,5)6;1-3-4-5-6(2)7/h1-6H3;3-5H2,1-2H3 |
| InChIKey | YSKBFMCKCHXPMV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |