C16H20N2O2S — CID 10828365
[4-(2-pyrrolidin-1-ylethoxy)phenyl]-(1,3-thiazol-5-yl)methanol (PubChem CID 10828365) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is [4-(2-pyrrolidin-1-ylethoxy)phenyl]-(1,3-thiazol-5-yl)methanol.
| Compound Name | [4-(2-pyrrolidin-1-ylethoxy)phenyl]-(1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 10828365 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [4-(2-pyrrolidin-1-ylethoxy)phenyl]-(1,3-thiazol-5-yl)methanol |
| SMILES | OC(c1ccc(OCCN2CCCC2)cc1)c1cncs1 |
| InChI | InChI=1S/C16H20N2O2S/c19-16(15-11-17-12-21-15)13-3-5-14(6-4-13)20-10-9-18-7-1-2-8-18/h3-6,11-12,16,19H,1-2,7-10H2 |
| InChIKey | SOODEVHYMZXQEH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |