C18H23NO4 — CID 10829288
benzyl N-[(1S)-2,2-dimethyl-1-[(2S)-4-methylidene-5-oxooxolan-2-yl]propyl]carbamate (PubChem CID 10829288) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is benzyl N-[(1S)-2,2-dimethyl-1-[(2S)-4-methylidene-5-oxooxolan-2-yl]propyl]carbamate.
| Compound Name | benzyl N-[(1S)-2,2-dimethyl-1-[(2S)-4-methylidene-5-oxooxolan-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 10829288 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | benzyl N-[(1S)-2,2-dimethyl-1-[(2S)-4-methylidene-5-oxooxolan-2-yl]propyl]carbamate |
| SMILES | C=C1C[C@@H]([C@@H](NC(=O)OCc2ccccc2)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C18H23NO4/c1-12-10-14(23-16(12)20)15(18(2,3)4)19-17(21)22-11-13-8-6-5-7-9-13/h5-9,14-15H,1,10-11H2,2-4H3,(H,19,21)/t14-,15+/m0/s1 |
| InChIKey | WCKPMWJLTHVKAL-LSDHHAIUSA-N |
| XLogP | 3.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|