C20H31NO2 — CID 10829312
(1R,9R,13S)-10-[(2R)-2-methoxypentyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 10829312) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (1R,9R,13S)-10-[(2R)-2-methoxypentyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,13S)-10-[(2R)-2-methoxypentyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 10829312 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (1R,9R,13S)-10-[(2R)-2-methoxypentyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | CCC[C@H](CN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@H]2C)OC |
| InChI | InChI=1S/C20H31NO2/c1-5-6-17(23-4)13-21-10-9-20(3)14(2)19(21)11-15-7-8-16(22)12-18(15)20/h7-8,12,14,17,19,22H,5-6,9-11,13H2,1-4H3/t14-,17-,19-,20-/m1/s1 |
| InChIKey | CZRKUPUQUCOJIK-SJFSSXKUSA-N |
| XLogP | 3.73 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |