C18H27N3O6S — CID 1083022
ethyl 4-[2-[4-(propan-2-ylsulfamoyl)phenoxy]acetyl]piperazine-1-carboxylate (PubChem CID 1083022) has the molecular formula C18H27N3O6S and a molecular weight of 413.50 g/mol. Its IUPAC name is ethyl 4-[2-[4-(propan-2-ylsulfamoyl)phenoxy]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-(propan-2-ylsulfamoyl)phenoxy]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 1083022 |
| Molecular Formula | C18H27N3O6S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | ethyl 4-[2-[4-(propan-2-ylsulfamoyl)phenoxy]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)COc2ccc(S(=O)(=O)NC(C)C)cc2)CC1 |
| InChI | InChI=1S/C18H27N3O6S/c1-4-26-18(23)21-11-9-20(10-12-21)17(22)13-27-15-5-7-16(8-6-15)28(24,25)19-14(2)3/h5-8,14,19H,4,9-13H2,1-3H3 |
| InChIKey | QLQULGSITRPDNL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |