About methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate
methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate (PubChem CID 10830321) has the molecular formula C13H24O2Sn
and a molecular weight of 331.04 g/mol. Its IUPAC name is methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate.
Analyze methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate?
The IUPAC name of methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate (CID 10830321) is methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate.
What is the SMILES notation for methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate?
The canonical SMILES for methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate is CCC(C(=O)OC)C(=C=C(C)C)[Sn](C)(C)C.
What is the InChIKey of methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate?
The InChIKey is YOTFRJCYIYNWBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15O2.3CH3.Sn/c1-5-9(10(11)12-4)7-6-8(2)3;;;;/h9H,5H2,1-4H3;3*1H3;.
What are the key properties of methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate?
methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate has a molecular weight of 331.04 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-5-methyl-3-trimethylstannylhexa-3,4-dienoate is sourced from PubChem (CID 10830321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).