C18H23N3O4 — CID 10831369
methyl (2S)-1-(2-ethyl-4-oxoquinazolin-3-yl)-2-[(1R)-1-hydroxybutyl]aziridine-2-carboxylate (PubChem CID 10831369) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl (2S)-1-(2-ethyl-4-oxoquinazolin-3-yl)-2-[(1R)-1-hydroxybutyl]aziridine-2-carboxylate.
| Compound Name | methyl (2S)-1-(2-ethyl-4-oxoquinazolin-3-yl)-2-[(1R)-1-hydroxybutyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 10831369 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | methyl (2S)-1-(2-ethyl-4-oxoquinazolin-3-yl)-2-[(1R)-1-hydroxybutyl]aziridine-2-carboxylate |
| SMILES | CCC[C@@H](O)[C@]1(C(=O)OC)CN1n1c(CC)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H23N3O4/c1-4-8-14(22)18(17(24)25-3)11-20(18)21-15(5-2)19-13-10-7-6-9-12(13)16(21)23/h6-7,9-10,14,22H,4-5,8,11H2,1-3H3/t14-,18+,20?/m1/s1 |
| InChIKey | HHNOTXLEGUSINL-KJOMBKDJSA-N |
| XLogP | 0.98 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|