C23H25N3O3 — CID 10385794
methyl (2R,3S)-2-methyl-1-[2-(2-methylpropyl)-4-oxoquinazolin-3-yl]-3-phenylaziridine-2-carboxylate (PubChem CID 10385794) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is methyl (2R,3S)-2-methyl-1-[2-(2-methylpropyl)-4-oxoquinazolin-3-yl]-3-phenylaziridine-2-carboxylate.
| Compound Name | methyl (2R,3S)-2-methyl-1-[2-(2-methylpropyl)-4-oxoquinazolin-3-yl]-3-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 10385794 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | methyl (2R,3S)-2-methyl-1-[2-(2-methylpropyl)-4-oxoquinazolin-3-yl]-3-phenylaziridine-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)[C@H](c2ccccc2)N1n1c(CC(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H25N3O3/c1-15(2)14-19-24-18-13-9-8-12-17(18)21(27)25(19)26-20(16-10-6-5-7-11-16)23(26,3)22(28)29-4/h5-13,15,20H,14H2,1-4H3/t20-,23+,26?/m0/s1 |
| InChIKey | KBTNQVCOBHXSJT-VEMNNVBWSA-N |
| XLogP | 3.22 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|