C22H34O3 — CID 10831466
(5S,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-propoxy-2,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-dione (PubChem CID 10831466) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (5S,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-propoxy-2,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-dione.
| Compound Name | (5S,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-propoxy-2,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-dione |
|---|---|
| PubChem CID | 10831466 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (5S,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-propoxy-2,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-dione |
| SMILES | CCCO[C@H]1C(=O)C[C@H]2[C@@H]3CC[C@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H34O3/c1-4-11-25-20-19(24)13-18-16-6-5-14-12-15(23)7-9-21(14,2)17(16)8-10-22(18,20)3/h14,16-18,20H,4-13H2,1-3H3/t14-,16+,17-,18-,20-,21-,22-/m0/s1 |
| InChIKey | FFJSEQPXZGAYJQ-PRXWIKJSSA-N |
| XLogP | 4.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |