C26H44O2 — CID 57309831
(8R,9R,10S,13S,14S)-17-heptoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57309831) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-17-heptoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10S,13S,14S)-17-heptoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57309831 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | (8R,9R,10S,13S,14S)-17-heptoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCCCCCCOC1CC[C@H]2[C@@H]3CCC4CC(=O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C26H44O2/c1-4-5-6-7-8-17-28-24-12-11-22-21-10-9-19-18-20(27)13-15-25(19,2)23(21)14-16-26(22,24)3/h19,21-24H,4-18H2,1-3H3/t19?,21-,22-,23+,24?,25-,26-/m0/s1 |
| InChIKey | HUTPASNYCBFLJN-AKBCUKNUSA-N |
| XLogP | 6.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|