C16H11ClN2O3S — CID 10831484
2-chloro-6-(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxothioxanthen-9-one (PubChem CID 10831484) has the molecular formula C16H11ClN2O3S and a molecular weight of 346.80 g/mol. Its IUPAC name is 2-chloro-6-(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxothioxanthen-9-one.
| Compound Name | 2-chloro-6-(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxothioxanthen-9-one |
|---|---|
| PubChem CID | 10831484 |
| Molecular Formula | C16H11ClN2O3S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-chloro-6-(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxothioxanthen-9-one |
| SMILES | O=C1c2cc(Cl)ccc2S(=O)(=O)c2cc(C3=NCCN3)ccc21 |
| InChI | InChI=1S/C16H11ClN2O3S/c17-10-2-4-13-12(8-10)15(20)11-3-1-9(16-18-5-6-19-16)7-14(11)23(13,21)22/h1-4,7-8H,5-6H2,(H,18,19) |
| InChIKey | VMRKITUFBCAJLW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |