C15H17N5O3S — CID 10831510
N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-(pyridin-2-ylamino)benzamide (PubChem CID 10831510) has the molecular formula C15H17N5O3S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-(pyridin-2-ylamino)benzamide.
| Compound Name | N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-(pyridin-2-ylamino)benzamide |
|---|---|
| PubChem CID | 10831510 |
| Molecular Formula | C15H17N5O3S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-(pyridin-2-ylamino)benzamide |
| SMILES | Cc1cc(Nc2ccccn2)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C15H17N5O3S/c1-9-7-11(19-13-5-3-4-6-18-13)12(24(2,22)23)8-10(9)14(21)20-15(16)17/h3-8H,1-2H3,(H,18,19)(H4,16,17,20,21) |
| InChIKey | PXXSCCRZKKNNIS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|