C19H19N3O5 — CID 10832867
ethyl 1-[(4-methoxyphenyl)carbamoyl]-3-oxo-2,4-dihydroquinoxaline-2-carboxylate (PubChem CID 10832867) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is ethyl 1-[(4-methoxyphenyl)carbamoyl]-3-oxo-2,4-dihydroquinoxaline-2-carboxylate.
| Compound Name | ethyl 1-[(4-methoxyphenyl)carbamoyl]-3-oxo-2,4-dihydroquinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 10832867 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | ethyl 1-[(4-methoxyphenyl)carbamoyl]-3-oxo-2,4-dihydroquinoxaline-2-carboxylate |
| SMILES | CCOC(=O)C1C(=O)Nc2ccccc2N1C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H19N3O5/c1-3-27-18(24)16-17(23)21-14-6-4-5-7-15(14)22(16)19(25)20-12-8-10-13(26-2)11-9-12/h4-11,16H,3H2,1-2H3,(H,20,25)(H,21,23) |
| InChIKey | ZBNNWMLFUXRRLH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|