C25H38O2 — CID 10832991
(6R)-6-[(1R,3aR,4E,7aR)-7a-methyl-4-[(2E)-2-(4-methylideneoxolan-3-ylidene)ethylidene]-2,3,3a,7-tetrahydro-1H-inden-1-yl]-2-methylheptan-2-ol (PubChem CID 10832991) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is (6R)-6-[(1R,3aR,4E,7aR)-7a-methyl-4-[(2E)-2-(4-methylideneoxolan-3-ylidene)ethylidene]-2,3,3a,7-tetrahydro-1H-inden-1-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(1R,3aR,4E,7aR)-7a-methyl-4-[(2E)-2-(4-methylideneoxolan-3-ylidene)ethylidene]-2,3,3a,7-tetrahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 10832991 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (6R)-6-[(1R,3aR,4E,7aR)-7a-methyl-4-[(2E)-2-(4-methylideneoxolan-3-ylidene)ethylidene]-2,3,3a,7-tetrahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
| SMILES | C=C1COC/C1=C/C=C1\C=CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)(C)O)CC[C@@H]12 |
| InChI | InChI=1S/C25H38O2/c1-18(8-6-14-24(3,4)26)22-12-13-23-20(9-7-15-25(22,23)5)10-11-21-17-27-16-19(21)2/h7,9-11,18,22-23,26H,2,6,8,12-17H2,1,3-5H3/b20-10+,21-11-/t18-,22-,23+,25-/m1/s1 |
| InChIKey | NYPALJWRYZHOFM-KTZDGRMWSA-N |
| XLogP | 6.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |