C28H46O2Si — CID 10765662
[(6R)-6-[(1R,3aR,4E,7aR)-7a-methyl-4-[(2E)-2-(4-methylideneoxolan-3-ylidene)ethylidene]-2,3,3a,7-tetrahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-trimethylsilane (PubChem CID 10765662) has the molecular formula C28H46O2Si and a molecular weight of 442.76 g/mol. Its IUPAC name is [(6R)-6-[(1R,3aR,4E,7aR)-7a-methyl-4-[(2E)-2-(4-methylideneoxolan-3-ylidene)ethylidene]-2,3,3a,7-tetrahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-trimethylsilane.
| Compound Name | [(6R)-6-[(1R,3aR,4E,7aR)-7a-methyl-4-[(2E)-2-(4-methylideneoxolan-3-ylidene)ethylidene]-2,3,3a,7-tetrahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10765662 |
| Molecular Formula | C28H46O2Si |
| Molecular Weight | 442.76 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | [(6R)-6-[(1R,3aR,4E,7aR)-7a-methyl-4-[(2E)-2-(4-methylideneoxolan-3-ylidene)ethylidene]-2,3,3a,7-tetrahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-trimethylsilane |
| SMILES | C=C1COC/C1=C/C=C1\C=CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)(C)O[Si](C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C28H46O2Si/c1-21(11-9-17-27(3,4)30-31(6,7)8)25-15-16-26-23(12-10-18-28(25,26)5)13-14-24-20-29-19-22(24)2/h10,12-14,21,25-26H,2,9,11,15-20H2,1,3-8H3/b23-13+,24-14-/t21-,25-,26+,28-/m1/s1 |
| InChIKey | UJJCKFWDYVDELQ-ZSADQFOTSA-N |
| XLogP | 7.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.76 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|