2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid

C17H15BrO5 — CID 10833560

IUPAC2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid
SMILESCOc1cc(CC(=O)O)c(C(=O)c2ccc(Br)cc2)cc1OC
InChIInChI=1S/C17H15BrO5/c1-22-14-7-11(8-16(19)20)13(9-15(14)23-2)17(21)10-3-5-12(18)6-4-10/h3-7,9H,8H2,1-2H3,(H,19,20)
InChIKeyPEBQPSJCICLJIZ-UHFFFAOYSA-N
MW379.21 g/mol
LogP3.32
Rot. Bonds6

About 2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid

2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid (PubChem CID 10833560) has the molecular formula C17H15BrO5 and a molecular weight of 379.21 g/mol. Its IUPAC name is 2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid.

Molecular Properties

Compound Name2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid
PubChem CID10833560
Molecular FormulaC17H15BrO5
Molecular Weight379.21 g/mol
Exact Mass378.01
IUPAC Name2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid
SMILESCOc1cc(CC(=O)O)c(C(=O)c2ccc(Br)cc2)cc1OC
InChIInChI=1S/C17H15BrO5/c1-22-14-7-11(8-16(19)20)13(9-15(14)23-2)17(21)10-3-5-12(18)6-4-10/h3-7,9H,8H2,1-2H3,(H,19,20)
InChIKeyPEBQPSJCICLJIZ-UHFFFAOYSA-N
XLogP3.32
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500379.21
LogP ≤ 53.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid?
The IUPAC name of 2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid (CID 10833560) is 2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid.
What is the SMILES notation for 2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid?
The canonical SMILES for 2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid is COc1cc(CC(=O)O)c(C(=O)c2ccc(Br)cc2)cc1OC.
What is the InChIKey of 2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid?
The InChIKey is PEBQPSJCICLJIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrO5/c1-22-14-7-11(8-16(19)20)13(9-15(14)23-2)17(21)10-3-5-12(18)6-4-10/h3-7,9H,8H2,1-2H3,(H,19,20).
What are the key properties of 2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid?
2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid has a molecular weight of 379.21 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-bromobenzoyl)-4,5-dimethoxyphenyl]acetic acid is sourced from PubChem (CID 10833560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).