C21H30ClNO3 — CID 10833606
[2-hydroxy-3-[2-[4-(3-hydroxyphenyl)butyl]phenoxy]propyl]-dimethylazanium chloride (PubChem CID 10833606) has the molecular formula C21H30ClNO3 and a molecular weight of 379.93 g/mol. Its IUPAC name is [2-hydroxy-3-[2-[4-(3-hydroxyphenyl)butyl]phenoxy]propyl]-dimethylazanium chloride.
| Compound Name | [2-hydroxy-3-[2-[4-(3-hydroxyphenyl)butyl]phenoxy]propyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 10833606 |
| Molecular Formula | C21H30ClNO3 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | [2-hydroxy-3-[2-[4-(3-hydroxyphenyl)butyl]phenoxy]propyl]-dimethylazanium chloride |
| SMILES | C[NH+](C)CC(O)COc1ccccc1CCCCc1cccc(O)c1.[Cl-] |
| InChI | InChI=1S/C21H29NO3.ClH/c1-22(2)15-20(24)16-25-21-13-6-5-11-18(21)10-4-3-8-17-9-7-12-19(23)14-17;/h5-7,9,11-14,20,23-24H,3-4,8,10,15-16H2,1-2H3;1H |
| InChIKey | QHALMOKACMSDSZ-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 54.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|