C20H25FO3 — CID 142468540
3-[2-[2-[2-(1-fluoroethoxy)butoxy]phenyl]ethyl]phenol (PubChem CID 142468540) has the molecular formula C20H25FO3 and a molecular weight of 332.42 g/mol. Its IUPAC name is 3-[2-[2-[2-(1-fluoroethoxy)butoxy]phenyl]ethyl]phenol.
| Compound Name | 3-[2-[2-[2-(1-fluoroethoxy)butoxy]phenyl]ethyl]phenol |
|---|---|
| PubChem CID | 142468540 |
| Molecular Formula | C20H25FO3 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 3-[2-[2-[2-(1-fluoroethoxy)butoxy]phenyl]ethyl]phenol |
| SMILES | CCC(COc1ccccc1CCc1cccc(O)c1)OC(C)F |
| InChI | InChI=1S/C20H25FO3/c1-3-19(24-15(2)21)14-23-20-10-5-4-8-17(20)12-11-16-7-6-9-18(22)13-16/h4-10,13,15,19,22H,3,11-12,14H2,1-2H3 |
| InChIKey | WETGERJFUZKXKE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |