About 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one
5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one (PubChem CID 10834006) has the molecular formula C10H18Br2O2Si2
and a molecular weight of 386.23 g/mol. Its IUPAC name is 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one.
Molecular Properties
| Compound Name | 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one |
| PubChem CID | 10834006 |
| Molecular Formula | C10H18Br2O2Si2 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 383.92 |
| IUPAC Name | 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one |
| SMILES | C[Si](C)(C)C1=C([Si](C)(C)C)C(Br)(Br)OC1=O |
| InChI | InChI=1S/C10H18Br2O2Si2/c1-15(2,3)7-8(16(4,5)6)10(11,12)14-9(7)13/h1-6H3 |
| InChIKey | YVZHLZXXHJADAW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one?
The IUPAC name of 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one (CID 10834006) is 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one.
What is the SMILES notation for 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one?
The canonical SMILES for 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one is C[Si](C)(C)C1=C([Si](C)(C)C)C(Br)(Br)OC1=O.
What is the InChIKey of 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one?
The InChIKey is YVZHLZXXHJADAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18Br2O2Si2/c1-15(2,3)7-8(16(4,5)6)10(11,12)14-9(7)13/h1-6H3.
What are the key properties of 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one?
5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one has a molecular weight of 386.23 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dibromo-3,4-bis(trimethylsilyl)furan-2-one is sourced from PubChem (CID 10834006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).