C10H18O3Si2 — CID 14979598
3,4-bis(trimethylsilyl)furan-2,5-dione (PubChem CID 14979598) has the molecular formula C10H18O3Si2 and a molecular weight of 242.42 g/mol. Its IUPAC name is 3,4-bis(trimethylsilyl)furan-2,5-dione.
| Compound Name | 3,4-bis(trimethylsilyl)furan-2,5-dione |
|---|---|
| PubChem CID | 14979598 |
| Molecular Formula | C10H18O3Si2 |
| Molecular Weight | 242.42 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3,4-bis(trimethylsilyl)furan-2,5-dione |
| SMILES | C[Si](C)(C)C1=C([Si](C)(C)C)C(=O)OC1=O |
| InChI | InChI=1S/C10H18O3Si2/c1-14(2,3)7-8(15(4,5)6)10(12)13-9(7)11/h1-6H3 |
| InChIKey | AWMNWOSKTCJYQH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|